ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
31366-25-3 Tetrathiafulvalene |
|
Naam product | Tetrathiafulvalene |
Engelse naam | Tetrathiafulvalene;delta2,2-Bi-1,3-dithiole;TTF;TetrathiafulvaleneTTForangextl;delta-2:2-bis(1,3-dithiazole);DELTA^2^,^2^-Bi-1,3-dithiole~TTF;2-(1,3-dithiol-2-ylidene)-1,3-dithiole |
MF | C6H4S4 |
Molecuulgewicht | 204.356 |
InChI | InChI=1/C6H4S4/c1-2-8-5(7-1)6-9-3-4-10-6/h1-4H |
CAS-nummer | 31366-25-3 |
EINECS | 250-593-7 |
Moleculaire Structuur | ![]() |
Dichtheid | 1.636g/cm3 |
Smeltpunt | 117-120℃ |
Kookpunt | 229°C at 760 mmHg |
Brekingsindex | 1.879 |
Vlampunt | 120.9°C |
Dampdruk | 0.107mmHg at 25°C |
Veiligheid Omschrijving | S24/25##Avoid contact with skin and eyes.:; |
MSDS |