ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
349545-75-1 4,4'-Bis[2-(3-methoxyphenyl)ethenyl]-2,2'-bipyridine |
|
| Naam product | 4,4'-Bis[2-(3-methoxyphenyl)ethenyl]-2,2'-bipyridine |
| Engelse naam | 4,4'-Bis[2-(3-methoxyphenyl)ethenyl]-2,2'-bipyridine; |
| MF | C28H24N2O2 |
| Molecuulgewicht | 420.5 |
| InChI | InChI=1/C28H24N2O2/c1-31-25-7-3-5-21(17-25)9-11-23-13-15-29-27(19-23)28-20-24(14-16-30-28)12-10-22-6-4-8-26(18-22)32-2/h3-20H,1-2H3 |
| CAS-nummer | 349545-75-1 |
| Moleculaire Structuur | ![]() |
| Brekingsindex | 1.685 |
| MSDS | |