ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
350997-56-7 3-methylthiofeen-2-carbohydrazide |
|
| Naam product | 3-methylthiofeen-2-carbohydrazide |
| Synoniemen | 2-thiofeencarbonzuur, 3-methyl-, hydrazide; 3-methylthiofeen-2-carbohydrazide; |
| Engelse naam | 3-methylthiophene-2-carbohydrazide;2-Thiophenecarboxylic acid, 3-methyl-, hydrazide;3-Methylthiophene-2-carbohydrazide |
| MF | C6H8N2OS |
| Molecuulgewicht | 156.2055 |
| InChI | InChI=1/C6H8N2OS/c1-4-2-3-10-5(4)6(9)8-7/h2-3H,7H2,1H3,(H,8,9) |
| CAS-nummer | 350997-56-7 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.273g/cm3 |
| Brekingsindex | 1.6 |
| MSDS | |