ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
376585-97-6 4-bromo-2-(1-methylethyl)-1,3-thiazole |
|
| Naam product | 4-bromo-2-(1-methylethyl)-1,3-thiazole |
| Engelse naam | 4-bromo-2-(1-methylethyl)-1,3-thiazole;4-Bromo-2-isopropyl-1,3-thiazole;Thiazole, 4-bromo-2-(1-methylethyl)- |
| MF | C6H8BrNS |
| Molecuulgewicht | 206.1034 |
| InChI | InChI=1/C6H8BrNS/c1-4(2)6-8-5(7)3-9-6/h3-4H,1-2H3 |
| CAS-nummer | 376585-97-6 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.489g/cm3 |
| Kookpunt | 218°C at 760 mmHg |
| Brekingsindex | 1.557 |
| Vlampunt | 85.7°C |
| Dampdruk | 0.19mmHg at 25°C |
| MSDS | |