ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
383417-46-7 4-nitrofenyl 2-O-(6-deoxyhexopyranosyl)hexopyranoside |
|
| Naam product | 4-nitrofenyl 2-O-(6-deoxyhexopyranosyl)hexopyranoside |
| Engelse naam | 4-nitrophenyl 2-O-(6-deoxyhexopyranosyl)hexopyranoside; |
| MF | C18H25NO12 |
| Molecuulgewicht | 447.3906 |
| InChI | InChI=1/C18H25NO12/c1-7-11(21)13(23)15(25)17(28-7)31-16-14(24)12(22)10(6-20)30-18(16)29-9-4-2-8(3-5-9)19(26)27/h2-5,7,10-18,20-25H,6H2,1H3 |
| CAS-nummer | 383417-46-7;66347-27-1;77640-21-2 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.62g/cm3 |
| Kookpunt | 740.5°C at 760 mmHg |
| Brekingsindex | 1.649 |
| Vlampunt | 401.7°C |
| Dampdruk | 4.99E-23mmHg at 25°C |
| MSDS | |