ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
385766-53-0 3-methyl-4-sulfanylpentan-2-on |
|
| Naam product | 3-methyl-4-sulfanylpentan-2-on |
| Synoniemen | 2-pentanon, 4-mercapto-3-methyl-; 4-Mercapto-3-methyl-pentaan-2-on; |
| Engelse naam | 3-methyl-4-sulfanylpentan-2-one;2-pentanone, 4-mercapto-3-methyl-;4-Mercapto-3-methyl-pentan-2-one |
| MF | C6H12OS |
| Molecuulgewicht | 132.2239 |
| InChI | InChI=1/C6H12OS/c1-4(5(2)7)6(3)8/h4,6,8H,1-3H3 |
| CAS-nummer | 385766-53-0 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 0.947g/cm3 |
| Kookpunt | 181.7°C at 760 mmHg |
| Brekingsindex | 1.452 |
| Vlampunt | 63.7°C |
| Dampdruk | 0.843mmHg at 25°C |
| MSDS | |