ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
3964-58-7 3-Chloro-4-hydroxybenzoic acid hemihydrate |
|
Naam product | 3-Chloro-4-hydroxybenzoic acid hemihydrate |
Engelse naam | 3-Chloro-4-hydroxybenzoic acid hemihydrate;3-Chloro-4-hydroxybenzoic acid;3-chloro-4-hydroxybenzoic acid hydrate;3-chloro-4-hydroxybenzoate |
MF | C7H4ClO3 |
Molecuulgewicht | 171.5584 |
InChI | InChI=1/C7H5ClO3/c8-5-3-4(7(10)11)1-2-6(5)9/h1-3,9H,(H,10,11)/p-1 |
CAS-nummer | 3964-58-7 |
EINECS | 223-574-6 |
Moleculaire Structuur | ![]() |
Smeltpunt | 168-172℃ |
Kookpunt | 330.5°C at 760 mmHg |
Vlampunt | 153.7°C |
Dampdruk | 6.65E-05mmHg at 25°C |
Veiligheid Omschrijving | S24/25##Avoid contact with skin and eyes.:; |
MSDS |