ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
400715-45-9 5-(2-methyl-1,3-thiazool-4-yl)-2-thiofeencarbonzuur |
|
Naam product | 5-(2-methyl-1,3-thiazool-4-yl)-2-thiofeencarbonzuur |
Synoniemen | 5-(2-methyl-1,3-thiazool-4-yl)-2-thiofeencarbonzuur; 5-(2-methyl-1,3-thiazool-4-yl)thiofeen-2-carbonzuur; |
Engelse naam | 5-(2-methyl-1,3-thiazol-4-yl)-2-thiophenecarboxylic acid;5-(2-Methyl-1,3-thiazol-4-yl)-2- thiophenecarboxylic acid;5-(2-methyl-1,3-thiazol-4-yl)thiophene-2-carboxylic acid |
MF | C9H7NO2S2 |
Molecuulgewicht | 225.2874 |
InChI | InChI=1/C9H7NO2S2/c1-5-10-6(4-13-5)7-2-3-8(14-7)9(11)12/h2-4H,1H3,(H,11,12) |
CAS-nummer | 400715-45-9 |
Moleculaire Structuur | ![]() |
Dichtheid | 1.446g/cm3 |
Smeltpunt | 230℃ |
Kookpunt | 434.4°C at 760 mmHg |
Brekingsindex | 1.659 |
Vlampunt | 216.5°C |
Dampdruk | 2.57E-08mmHg at 25°C |
Gevaarsymbolen | |
Risico-codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Veiligheid Omschrijving | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |