ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
42172-35-0 3-methylhexadecaanzuur |
|
| Naam product | 3-methylhexadecaanzuur |
| Synoniemen | 3-methylhexadecaanzuur; hexadecaanzuur, 3-methyl-; |
| Engelse naam | 3-methylhexadecanoic acid;3-Methylhexadecanoic acid;hexadecanoic acid, 3-methyl- |
| MF | C17H34O2 |
| Molecuulgewicht | 270.4507 |
| InChI | InChI=1/C17H34O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-16(2)15-17(18)19/h16H,3-15H2,1-2H3,(H,18,19) |
| CAS-nummer | 42172-35-0 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 0.889g/cm3 |
| Kookpunt | 386.1°C at 760 mmHg |
| Brekingsindex | 1.453 |
| Vlampunt | 216.6°C |
| Dampdruk | 4.94E-07mmHg at 25°C |
| MSDS | |