ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
4312-99-6 1-Octen-3-one |
|
Naam product | 1-Octen-3-one |
Engelse naam | 1-Octen-3-one;n-Amyl vinyl ketone~n-Pentyl vinyl ketone;oct-1-en-3-one |
MF | C8H14O |
Molecuulgewicht | 126.1962 |
InChI | InChI=1/C8H14O/c1-3-5-6-7-8(9)4-2/h4H,2-3,5-7H2,1H3 |
CAS-nummer | 4312-99-6 |
EINECS | 224-327-5 |
Moleculaire Structuur | ![]() |
Dichtheid | 0.825g/cm3 |
Kookpunt | 177°C at 760 mmHg |
Brekingsindex | 1.422 |
Vlampunt | 58.5°C |
Dampdruk | 1.06mmHg at 25°C |
Risico-codes | R10##Flammable.||R36/38##Irritating to eyes and skin.:; |
Veiligheid Omschrijving | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |