ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
474843-42-0 methyl-3-amino-5-(3-nitrofenyl)thiofeen-2-carboxylaat |
|
| Naam product | methyl-3-amino-5-(3-nitrofenyl)thiofeen-2-carboxylaat |
| Synoniemen | 2-thiofeencarbonzuur, 3-amino-5-(3-nitrofenyl)-, methylester; Methyl 3-amino-5-(3-nitrofenyl)thiofeen-2-carboxylaat; |
| Engelse naam | methyl 3-amino-5-(3-nitrophenyl)thiophene-2-carboxylate;2-Thiophenecarboxylic acid, 3-amino-5-(3-nitrophenyl)-, methyl ester;Methyl 3-amino-5-(3-nitrophenyl)thiophene-2-carboxylate |
| MF | C12H10N2O4S |
| Molecuulgewicht | 278.2838 |
| InChI | InChI=1/C12H10N2O4S/c1-18-12(15)11-9(13)6-10(19-11)7-3-2-4-8(5-7)14(16)17/h2-6H,13H2,1H3 |
| CAS-nummer | 474843-42-0 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.418g/cm3 |
| Kookpunt | 515.8°C at 760 mmHg |
| Brekingsindex | 1.652 |
| Vlampunt | 265.7°C |
| Dampdruk | 9.53E-11mmHg at 25°C |
| MSDS | |