ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
484-17-3 9-Phenanthrol |
|
Naam product | 9-Phenanthrol |
Engelse naam | 9-Phenanthrol;9-Hydroxyphenanthrene;phenanthren-9-ol |
MF | C14H10O |
Molecuulgewicht | 194.2286 |
InChI | InChI=1/C14H10O/c15-14-9-10-5-1-2-6-11(10)12-7-3-4-8-13(12)14/h1-9,15H |
CAS-nummer | 484-17-3 |
EINECS | 207-602-4 |
Moleculaire Structuur | ![]() |
Dichtheid | 1.244g/cm3 |
Smeltpunt | 139-143℃ |
Kookpunt | 404.5°C at 760 mmHg |
Brekingsindex | 1.753 |
Vlampunt | 197.7°C |
Dampdruk | 4.02E-07mmHg at 25°C |
Veiligheid Omschrijving | S24/25##Avoid contact with skin and eyes.:; |
MSDS |