ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
499785-46-5 4-pyridine-2-ylisoxazol-5-amine |
|
Naam product | 4-pyridine-2-ylisoxazol-5-amine |
Engelse naam | 4-pyridin-2-ylisoxazol-5-amine; |
MF | C8H7N3O |
Molecuulgewicht | 161.1607 |
InChI | InChI=1/C8H7N3O/c9-8-6(5-11-12-8)7-3-1-2-4-10-7/h1-5H,9H2 |
CAS-nummer | 499785-46-5 |
Moleculaire Structuur | ![]() |
Dichtheid | 1.276g/cm3 |
Smeltpunt | 148℃ |
Kookpunt | 355.9°C at 760 mmHg |
Brekingsindex | 1.606 |
Vlampunt | 169°C |
Dampdruk | 3.03E-05mmHg at 25°C |
Veiligheid Omschrijving | S24/25##Avoid contact with skin and eyes.:; |
MSDS |