ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
51721-68-7 4-methoxybenzamidine, hydrochloride |
|
| Naam product | 4-methoxybenzamidine, hydrochloride |
| Synoniemen | amino(4-methoxyfenyl)methaniminiumchloride; |
| Engelse naam | 4-Methoxybenzamidine, Hydrochloride;amino(4-methoxyphenyl)methaniminium chloride |
| MF | C8H11ClN2O |
| Molecuulgewicht | 186.6387 |
| InChI | InChI=1/C8H10N2O.ClH/c1-11-7-4-2-6(3-5-7)8(9)10;/h2-5H,1H3,(H3,9,10);1H |
| CAS-nummer | 51721-68-7 |
| Moleculaire Structuur | ![]() |
| Kookpunt | 255.1°C at 760 mmHg |
| Vlampunt | 108.1°C |
| Dampdruk | 0.0166mmHg at 25°C |
| MSDS | |