ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
5223-04-1 5-(4-methoxyfenyl)-2-methyl-1,3-thiazool-4-ol |
|
| Naam product | 5-(4-methoxyfenyl)-2-methyl-1,3-thiazool-4-ol |
| Engelse naam | 5-(4-methoxyphenyl)-2-methyl-1,3-thiazol-4-ol; |
| MF | C11H11NO2S |
| Molecuulgewicht | 221.2755 |
| InChI | InChI=1/C11H11NO2S/c1-7-12-11(13)10(15-7)8-3-5-9(14-2)6-4-8/h3-6,13H,1-2H3 |
| CAS-nummer | 5223-04-1;59484-46-7 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.256g/cm3 |
| Kookpunt | 367.6°C at 760 mmHg |
| Brekingsindex | 1.605 |
| Vlampunt | 176.1°C |
| Dampdruk | 6.37E-06mmHg at 25°C |
| MSDS | |