ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
5228-48-8 2-Methyl-5-nitro-2H-indazole |
|
Naam product | 2-Methyl-5-nitro-2H-indazole |
Engelse naam | 2-Methyl-5-nitro-2H-indazole;Methylnitroindazole;2-Methyl-5-nitro-1H-indazole |
MF | C8H7N3O2 |
Molecuulgewicht | 177.1601 |
InChI | InChI=1/C8H7N3O2/c1-10-5-6-4-7(11(12)13)2-3-8(6)9-10/h2-5H,1H3 |
CAS-nummer | 5228-48-8 |
Moleculaire Structuur | ![]() |
Dichtheid | 1.425g/cm3 |
Smeltpunt | 161-163℃ |
Kookpunt | 364.502°C at 760 mmHg |
Brekingsindex | 1.677 |
Vlampunt | 174.245°C |
Dampdruk | 0mmHg at 25°C |
Veiligheid Omschrijving | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |