ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
52392-24-2 5-oxo-DL-proline, verbinding met dodecylglycinaat (1:1) |
|
| Naam product | 5-oxo-DL-proline, verbinding met dodecylglycinaat (1:1) |
| Synoniemen | 5-Oxo-DL-proline, verbinding met dodecylglycinaat (1:1); 5-oxoproline - dodecylglycinaat (1:1); |
| Engelse naam | 5-oxo-DL-proline, compound with dodecyl glycinate (1:1);5-Oxo-DL-proline, compound with dodecyl glycinate (1:1);5-oxoproline - dodecyl glycinate (1:1) |
| MF | C19H36N2O5 |
| Molecuulgewicht | 372.4995 |
| InChI | InChI=1/C14H29NO2.C5H7NO3/c1-2-3-4-5-6-7-8-9-10-11-12-17-14(16)13-15;7-4-2-1-3(6-4)5(8)9/h2-13,15H2,1H3;3H,1-2H2,(H,6,7)(H,8,9) |
| CAS-nummer | 52392-24-2 |
| EINECS | 257-893-7 |
| Moleculaire Structuur | ![]() |
| Kookpunt | 315.2°C at 760 mmHg |
| Vlampunt | 167.8°C |
| Dampdruk | 0.000445mmHg at 25°C |
| MSDS | |