ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
525-82-6 Flavone |
|
Naam product | Flavone |
Engelse naam | Flavone;2-Phenyl-4H-1-benzopyran-4-one;2-Phenylchromone;Flavone(2-Phenylchromone);2-phenyl-4H-chromen-4-one |
MF | C15H10O2 |
Molecuulgewicht | 222.2387 |
InChI | InChI=1/C15H10O2/c16-13-10-15(11-6-2-1-3-7-11)17-14-9-5-4-8-12(13)14/h1-10H |
CAS-nummer | 525-82-6 |
EINECS | 208-383-8 |
Moleculaire Structuur | ![]() |
Dichtheid | 1.239g/cm3 |
Smeltpunt | 96-98℃ |
Kookpunt | 367°C at 760 mmHg |
Brekingsindex | 1.635 |
Vlampunt | 171.1°C |
Dampdruk | 1.41E-05mmHg at 25°C |
Veiligheid Omschrijving | S24/25##Avoid contact with skin and eyes.:; |
MSDS |