ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
52662-10-9 4,6-dimethyl-3-(bèta-D-ribofuranosyl)-3,4-dihydro-9H-imidazo[1,2-a]purin-9-on |
|
| Naam product | 4,6-dimethyl-3-(bèta-D-ribofuranosyl)-3,4-dihydro-9H-imidazo[1,2-a]purin-9-on |
| Synoniemen | 9H-imidazo(1,2-a)purin-9-on, 3,4-dihydro-4,6-dimethyl-3-bèta-D-ribofuranosyl-; |
| Engelse naam | 4,6-dimethyl-3-(beta-D-ribofuranosyl)-3,4-dihydro-9H-imidazo[1,2-a]purin-9-one;9H-Imidazo(1,2-a)purin-9-one, 3,4-dihydro-4,6-dimethyl-3-beta-D-ribofuranosyl- |
| MF | C14H17N5O5 |
| Molecuulgewicht | 335.3153 |
| InChI | InChI=1/C14H17N5O5/c1-6-3-18-12(23)8-11(17(2)14(18)16-6)19(5-15-8)13-10(22)9(21)7(4-20)24-13/h3,5,7,9-10,13,20-22H,4H2,1-2H3/t7-,9-,10-,13-/m1/s1 |
| CAS-nummer | 52662-10-9 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.86g/cm3 |
| Kookpunt | 827.6°C at 760 mmHg |
| Brekingsindex | 1.835 |
| Vlampunt | 454.3°C |
| Dampdruk | 5.13E-29mmHg at 25°C |
| MSDS | |