ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
53020-05-6 4,6-dimethoxy-3-methyl-1-benzofuran-2-carbonitrile |
|
| Naam product | 4,6-dimethoxy-3-methyl-1-benzofuran-2-carbonitrile |
| Engelse naam | 4,6-dimethoxy-3-methyl-1-benzofuran-2-carbonitrile; |
| MF | C12H11NO3 |
| Molecuulgewicht | 217.2206 |
| InChI | InChI=1/C12H11NO3/c1-7-11(6-13)16-10-5-8(14-2)4-9(15-3)12(7)10/h4-5H,1-3H3 |
| CAS-nummer | 53020-05-6 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.22g/cm3 |
| Kookpunt | 372.1°C at 760 mmHg |
| Brekingsindex | 1.577 |
| Vlampunt | 178.9°C |
| Dampdruk | 9.81E-06mmHg at 25°C |
| MSDS | |