ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
54108-78-0 4-amino-2-methyl-7-(propan-2-yl)-1H-isoindole-1,3(2H)-dione |
|
| Naam product | 4-amino-2-methyl-7-(propan-2-yl)-1H-isoindole-1,3(2H)-dione |
| Engelse naam | 4-amino-2-methyl-7-(propan-2-yl)-1H-isoindole-1,3(2H)-dione; |
| MF | C12H14N2O2 |
| Molecuulgewicht | 218.2518 |
| InChI | InChI=1/C12H14N2O2/c1-6(2)7-4-5-8(13)10-9(7)11(15)14(3)12(10)16/h4-6H,13H2,1-3H3 |
| CAS-nummer | 54108-78-0 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.247g/cm3 |
| Kookpunt | 382.8°C at 760 mmHg |
| Brekingsindex | 1.611 |
| Vlampunt | 185.3°C |
| Dampdruk | 4.59E-06mmHg at 25°C |
| MSDS | |