ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
54410-98-9 4,6,8-trimethylnon-1-een |
|
| Naam product | 4,6,8-trimethylnon-1-een |
| Synoniemen | 1-Noneen, 4,6,8-trimethyl-; 4,6,8-TRIMETHYL-1-NONEEN; |
| Engelse naam | 4,6,8-trimethylnon-1-ene;1-Nonene, 4,6,8-trimethyl-;4,6,8-TRIMETHYL-1-NONENE |
| MF | C12H24 |
| Molecuulgewicht | 168.319 |
| InChI | InChI=1/C12H24/c1-6-7-11(4)9-12(5)8-10(2)3/h6,10-12H,1,7-9H2,2-5H3 |
| CAS-nummer | 54410-98-9 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 0.755g/cm3 |
| Kookpunt | 195.7°C at 760 mmHg |
| Brekingsindex | 1.427 |
| Vlampunt | 71.5°C |
| Dampdruk | 0.581mmHg at 25°C |
| MSDS | |