ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
54582-90-0 4-chloor-3,5-dimethyl-2-nitrofenol |
|
| Naam product | 4-chloor-3,5-dimethyl-2-nitrofenol |
| Engelse naam | 4-chloro-3,5-dimethyl-2-nitrophenol; |
| MF | C8H8ClNO3 |
| Molecuulgewicht | 201.607 |
| InChI | InChI=1/C8H8ClNO3/c1-4-3-6(11)8(10(12)13)5(2)7(4)9/h3,11H,1-2H3 |
| CAS-nummer | 54582-90-0 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.398g/cm3 |
| Kookpunt | 288.5°C at 760 mmHg |
| Brekingsindex | 1.598 |
| Vlampunt | 128.3°C |
| Dampdruk | 0.00134mmHg at 25°C |
| MSDS | |