ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
55055-25-9 4,6-dimethylpyrimidin-2-yl thiocyanate |
|
| Naam product | 4,6-dimethylpyrimidin-2-yl thiocyanate |
| Engelse naam | 4,6-dimethylpyrimidin-2-yl thiocyanate; |
| MF | C7H7N3S |
| Molecuulgewicht | 165.2156 |
| InChI | InChI=1/C7H7N3S/c1-5-3-6(2)10-7(9-5)11-4-8/h3H,1-2H3 |
| CAS-nummer | 55055-25-9 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.25g/cm3 |
| Kookpunt | 332.2°C at 760 mmHg |
| Brekingsindex | 1.583 |
| Vlampunt | 154.7°C |
| Dampdruk | 0.000148mmHg at 25°C |
| MSDS | |