ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
56594-78-6 4,6-dimethylazuleen |
|
| Naam product | 4,6-dimethylazuleen |
| Synoniemen | Azuleen, 4,6-dimethyl-; |
| Engelse naam | 4,6-dimethylazulene;Azulene, 4,6-dimethyl- |
| MF | C12H12 |
| Molecuulgewicht | 156.2237 |
| InChI | InChI=1/C12H12/c1-9-6-7-11-4-3-5-12(11)10(2)8-9/h3-8H,1-2H3 |
| CAS-nummer | 56594-78-6 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1g/cm3 |
| Kookpunt | 263.7°C at 760 mmHg |
| Brekingsindex | 1.604 |
| Vlampunt | 109.9°C |
| Dampdruk | 0.0165mmHg at 25°C |
| MSDS | |