ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
56809-84-8 3,4-Dichloro-5-nitropyridine |
|
| Naam product | 3,4-Dichloro-5-nitropyridine |
| Engelse naam | 3,4-Dichloro-5-nitropyridine; |
| MF | C5H2Cl2N2O2 |
| Molecuulgewicht | 192.9876 |
| InChI | InChI=1/C5H2Cl2N2O2/c6-3-1-8-2-4(5(3)7)9(10)11/h1-2H |
| CAS-nummer | 56809-84-8 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.63g/cm3 |
| Kookpunt | 258.751°C at 760 mmHg |
| Brekingsindex | 1.603 |
| Vlampunt | 110.289°C |
| Dampdruk | 0.022mmHg at 25°C |
| MSDS | |