ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
57645-37-1 4-[(4-ammonio-2-methoxybenzoyl)amino]-1-benzylpiperidiniumdichloride |
|
| Naam product | 4-[(4-ammonio-2-methoxybenzoyl)amino]-1-benzylpiperidiniumdichloride |
| Engelse naam | 4-[(4-ammonio-2-methoxybenzoyl)amino]-1-benzylpiperidinium dichloride; |
| MF | C20H27Cl2N3O2 |
| Molecuulgewicht | 412.3533 |
| InChI | InChI=1/C20H25N3O2.2ClH/c1-25-19-13-16(21)7-8-18(19)20(24)22-17-9-11-23(12-10-17)14-15-5-3-2-4-6-15;;/h2-8,13,17H,9-12,14,21H2,1H3,(H,22,24);2*1H |
| CAS-nummer | 57645-37-1 |
| Moleculaire Structuur | ![]() |
| Kookpunt | 530.3°C at 760 mmHg |
| Vlampunt | 274.5°C |
| Dampdruk | 2.5E-11mmHg at 25°C |
| MSDS | |