ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
58910-25-1 4-Ethyl-5-methyl-2H-1,2,4-triazol-3(4H)-one |
|
| Naam product | 4-Ethyl-5-methyl-2H-1,2,4-triazol-3(4H)-one |
| Engelse naam | 4-Ethyl-5-methyl-2H-1,2,4-triazol-3(4H)-one;3H-1,2,4-triazol-3-one, 4-ethyl-2,4-dihydro-5-methyl-;4-Ethyl-5-methyl-2,4-dihydro-3H-1,2,4-triazol-3-one |
| MF | C5H9N3O |
| Molecuulgewicht | 127.1445 |
| InChI | InChI=1/C5H9N3O/c1-3-8-4(2)6-7-5(8)9/h3H2,1-2H3,(H,7,9) |
| CAS-nummer | 58910-25-1 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.27g/cm3 |
| Brekingsindex | 1.586 |
| MSDS | |