ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
59020-44-9 4-Phenylthiazole-2-carboxylic acid |
|
| Naam product | 4-Phenylthiazole-2-carboxylic acid |
| Engelse naam | 4-Phenylthiazole-2-carboxylic acid;4-Phenyl-1,3-thiazole-2-carboxylic acid |
| MF | C10H7NO2S |
| Molecuulgewicht | 205.2331 |
| InChI | InChI=1/C10H7NO2S/c12-10(13)9-11-8(6-14-9)7-4-2-1-3-5-7/h1-6H,(H,12,13) |
| CAS-nummer | 59020-44-9 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.368g/cm3 |
| Kookpunt | 431.5°C at 760 mmHg |
| Brekingsindex | 1.643 |
| Vlampunt | 214.8°C |
| Dampdruk | 3.26E-08mmHg at 25°C |
| MSDS | |