ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
59969-31-2 4-[cyclohexylidene(4-hydroxyphenyl)methyl]phenyl 4-O-methylhexopyranoside |
|
| Naam product | 4-[cyclohexylidene(4-hydroxyphenyl)methyl]phenyl 4-O-methylhexopyranoside |
| Engelse naam | 4-[cyclohexylidene(4-hydroxyphenyl)methyl]phenyl 4-O-methylhexopyranoside; |
| MF | C26H32O7 |
| Molecuulgewicht | 456.5281 |
| InChI | InChI=1/C26H32O7/c1-31-25-21(15-27)33-26(24(30)23(25)29)32-20-13-9-18(10-14-20)22(16-5-3-2-4-6-16)17-7-11-19(28)12-8-17/h7-14,21,23-30H,2-6,15H2,1H3 |
| CAS-nummer | 59969-31-2 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.32g/cm3 |
| Kookpunt | 684.6°C at 760 mmHg |
| Brekingsindex | 1.635 |
| Vlampunt | 367.8°C |
| Dampdruk | 1.11E-19mmHg at 25°C |
| MSDS | |