ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
607-28-3 Isatin-3-oxime |
|
| Naam product | Isatin-3-oxime |
| Engelse naam | Isatin-3-oxime;3-hydroxyiminoindolin-2-one;beta-Isatoxime;3-(hydroxyamino)-2H-indol-2-one |
| MF | C8H6N2O2 |
| Molecuulgewicht | 162.1454 |
| InChI | InChI=1/C8H6N2O2/c11-8-7(10-12)5-3-1-2-4-6(5)9-8/h1-4,12H,(H,9,10,11) |
| CAS-nummer | 607-28-3 |
| EINECS | 210-132-2 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.49g/cm3 |
| Smeltpunt | 210-214℃ |
| Kookpunt | 400.5°C at 760 mmHg |
| Brekingsindex | 1.706 |
| Vlampunt | 196°C |
| Dampdruk | 4.43E-08mmHg at 25°C |
| Veiligheid Omschrijving | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |