Chemindex > 608-08-2
NL ▼
608-08-2 Indoxyl acetate |
|
| Naam product | Indoxyl acetate |
| Engelse naam | Indoxyl acetate;3-Acetoxyindole~Indolyl acetate~Y-acetate;Indoxyl acetate 3-Indoxyl acetate;3-Indolyl acetate;3-Acetoxyindole;1H-indol-3-yl acetate |
| MF | C10H9NO2 |
| Molecuulgewicht | 175.184 |
| InChI | InChI=1/C10H9NO2/c1-7(12)13-10-6-11-9-5-3-2-4-8(9)10/h2-6,11H,1H3 |
| CAS-nummer | 608-08-2 |
| EINECS | 210-154-2 |
| Moleculaire Structuur |  |
| Dichtheid | 1.255g/cm3 |
| Smeltpunt | 128-131℃ |
| Kookpunt | 339.1°C at 760 mmHg |
| Brekingsindex | 1.633 |
| Vlampunt | 158.9°C |
| Dampdruk | 9.41E-05mmHg at 25°C |
| Veiligheid Omschrijving | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |
- Als u van plan bent om chemicaliën uit China te halen, ga dan naar het winkelcentrum ChemNet, we krijgen de nieuwste en concurrerende prijs van Chinese fabrikanten voor u.Bezoek ChemNet Mall om te informeren naar de prijs van
Indoxyl acetate 608-08-2
Chemical CAS Database Service wordt geleverd door ChemIndex.com 