ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
609-11-0 Ethyl 2,3-dibromobutyrate |
|
| Naam product | Ethyl 2,3-dibromobutyrate |
| Engelse naam | Ethyl 2,3-dibromobutyrate;2,3-Dibromobutyric acid ethyl ester;2,3-Dibromo-n-butyric acid ethyl ester;ethyl 2,3-dibromobutanoate |
| MF | C6H10Br2O2 |
| Molecuulgewicht | 273.9504 |
| InChI | InChI=1/C6H10Br2O2/c1-3-10-6(9)5(8)4(2)7/h4-5H,3H2,1-2H3 |
| CAS-nummer | 609-11-0 |
| EINECS | 210-177-8 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.731g/cm3 |
| Kookpunt | 226.7°C at 760 mmHg |
| Brekingsindex | 1.506 |
| Vlampunt | 90.9°C |
| Dampdruk | 0.0809mmHg at 25°C |
| Risico-codes | R34##Causes burns.:; |
| Veiligheid Omschrijving | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |