ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
61-32-5 meticillin |
|
| Naam product | meticillin |
| Engelse naam | meticillin;Methicillin; Staphcillin; ;(2S,5R,6R)-6-[(2,6-dimethoxybenzoyl)amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| MF | C17H20N2O6S |
| Molecuulgewicht | 380.4155 |
| InChI | InChI=1/C17H20N2O6S/c1-17(2)12(16(22)23)19-14(21)11(15(19)26-17)18-13(20)10-8(24-3)6-5-7-9(10)25-4/h5-7,11-12,15H,1-4H3,(H,18,20)(H,22,23)/t11-,12+,15-/m1/s1 |
| CAS-nummer | 61-32-5 |
| EINECS | 200-505-8 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.44g/cm3 |
| Kookpunt | 640°C at 760 mmHg |
| Brekingsindex | 1.638 |
| Vlampunt | 340.9°C |
| Dampdruk | 2.94E-17mmHg at 25°C |
| MSDS | |