ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
61-50-7 2-(indol-3-yl)ethyldimethylamine |
|
| Naam product | 2-(indol-3-yl)ethyldimethylamine |
| Engelse naam | 2-(indol-3-yl)ethyldimethylamine;N,N-Dimethyltryptamine;NOMEGA,NOMEGA-Dimethyltryptamine;2-(1H-indol-3-yl)-N,N-dimethylethanamine |
| MF | C12H16N2 |
| Molecuulgewicht | 188.2688 |
| InChI | InChI=1/C12H16N2/c1-14(2)8-7-10-9-13-12-6-4-3-5-11(10)12/h3-6,9,13H,7-8H2,1-2H3 |
| CAS-nummer | 61-50-7 |
| EINECS | 200-508-4 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.076g/cm3 |
| Kookpunt | 332.1°C at 760 mmHg |
| Brekingsindex | 1.615 |
| Vlampunt | 154.7°C |
| Dampdruk | 0.000149mmHg at 25°C |
| MSDS | |