ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
61-54-1 Tryptamine |
|
| Naam product | Tryptamine |
| Engelse naam | Tryptamine;3-(2-Aminoethyl)indole~2-(3-Indolyl)ethylamine;2-(indol-3-yl)ethylamine;3-(2-Aminoethyl)Indole;2-(1H-indol-3-yl)ethanamine |
| MF | C10H12N2 |
| Molecuulgewicht | 160.2157 |
| InChI | InChI=1/C10H12N2/c11-6-5-8-7-12-10-4-2-1-3-9(8)10/h1-4,7,12H,5-6,11H2 |
| CAS-nummer | 61-54-1 |
| EINECS | 200-510-5 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.157g/cm3 |
| Smeltpunt | 113-117℃ |
| Kookpunt | 378.8°C at 760 mmHg |
| Brekingsindex | 1.668 |
| Vlampunt | 187.7°C |
| Oplosbaarheid in water | negligible |
| Dampdruk | 6.14E-06mmHg at 25°C |
| Veiligheid Omschrijving | S24/25:; |
| MSDS | |