ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
709-09-1 1,2-Dimethoxy-4-nitrobenzene |
|
| Naam product | 1,2-Dimethoxy-4-nitrobenzene |
| Engelse naam | 1,2-Dimethoxy-4-nitrobenzene;4-Nitroveratrole;1,2-dimethoxy-4-nitro-benzen;3,4-Dimethoxynitrobenzene;4-Nitrcveratrole;4-NITRO-1,2-DIMETHOXYBENZENE;Benzene, 1,2-dimethoxy-4-nitro-;3,4-dimethoxy-nitrobenzene |
| MF | C8H7IO2 |
| Molecuulgewicht | 262.0444 |
| InChI | InChI=1/C8H7IO2/c1-5-2-3-6(8(10)11)4-7(5)9/h2-4H,1H3,(H,10,11) |
| CAS-nummer | 709-09-1 |
| EINECS | 211-906-2 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.867g/cm3 |
| Smeltpunt | 95-98℃ |
| Kookpunt | 355.2°C at 760 mmHg |
| Brekingsindex | 1.645 |
| Vlampunt | 168.6°C |
| Dampdruk | 1.16E-05mmHg at 25°C |
| Gevaarsymbolen | |
| Risico-codes | 22:; |
| Veiligheid Omschrijving | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |