ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
72727-63-0 fenethylundec-10-enoaat |
|
| Naam product | fenethylundec-10-enoaat |
| Synoniemen | 10-Undeceenzuur, 2-fenylethylester; Fenethylundec-10-enoaat; 2-fenylethylundec-10-enoaat; |
| Engelse naam | phenethyl undec-10-enoate;10-Undecenoic acid, 2-phenylethyl ester;Phenethyl undec-10-enoate;2-phenylethyl undec-10-enoate |
| MF | C19H28O2 |
| Molecuulgewicht | 288.4244 |
| InChI | InChI=1/C19H28O2/c1-2-3-4-5-6-7-8-12-15-19(20)21-17-16-18-13-10-9-11-14-18/h2,9-11,13-14H,1,3-8,12,15-17H2 |
| CAS-nummer | 72727-63-0 |
| EINECS | 276-796-0 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 0.953g/cm3 |
| Kookpunt | 384.7°C at 760 mmHg |
| Brekingsindex | 1.495 |
| Vlampunt | 117.7°C |
| Dampdruk | 4.02E-06mmHg at 25°C |
| MSDS | |