ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
73790-68-8 1-[1-(4-chloorfenyl)butyl]-4-methylpiperidinehydrochloride |
|
| Naam product | 1-[1-(4-chloorfenyl)butyl]-4-methylpiperidinehydrochloride |
| Engelse naam | 1-[1-(4-chlorophenyl)butyl]-4-methylpiperidine hydrochloride; |
| MF | C16H25Cl2N |
| Molecuulgewicht | 302.2824 |
| InChI | InChI=1/C16H24ClN.ClH/c1-3-4-16(14-5-7-15(17)8-6-14)18-11-9-13(2)10-12-18;/h5-8,13,16H,3-4,9-12H2,1-2H3;1H |
| CAS-nummer | 73790-68-8 |
| Moleculaire Structuur | ![]() |
| Kookpunt | 332.8°C at 760 mmHg |
| Vlampunt | 155.1°C |
| Dampdruk | 0.000143mmHg at 25°C |
| MSDS | |