ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
7730-20-3 6-Fluoro-DL-tryptophan |
|
Naam product | 6-Fluoro-DL-tryptophan |
Engelse naam | 6-Fluoro-DL-tryptophan;6-Fluoro-DL-tryptophane;2-Amino-3-(6-fluoro-1H-indol-3-yl)propanoic acid;6-fluoro-L-tryptophan;6-fluoro-D-tryptophan |
MF | C11H11FN2O2 |
Molecuulgewicht | 222.2156 |
InChI | InChI=1/C11H11FN2O2/c12-7-1-2-8-6(3-9(13)11(15)16)5-14-10(8)4-7/h1-2,4-5,9,14H,3,13H2,(H,15,16)/t9-/m1/s1 |
CAS-nummer | 7730-20-3 |
EINECS | 231-788-6 |
Moleculaire Structuur | ![]() |
Dichtheid | 1.442g/cm3 |
Smeltpunt | 280-28500℃ |
Kookpunt | 450.7°C at 760 mmHg |
Brekingsindex | 1.673 |
Vlampunt | 226.4°C |
Dampdruk | 6.54E-09mmHg at 25°C |
Veiligheid Omschrijving | S24/25##Avoid contact with skin and eyes.:; |
MSDS |