ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
7791-49-3 5-Methoxybenzofurazan-1-oxide |
|
Naam product | 5-Methoxybenzofurazan-1-oxide |
Engelse naam | 5-Methoxybenzofurazan-1-oxide;5-Methoxybenzofurazan 1-oxide;5-Methoxybenzofuroxan;5-methoxy-2,1,3-benzoxadiazole 1-oxide |
MF | C7H6N2O3 |
Molecuulgewicht | 166.1341 |
InChI | InChI=1/C7H6N2O3/c1-11-5-2-3-7-6(4-5)8-12-9(7)10/h2-4H,1H3 |
CAS-nummer | 7791-49-3 |
Moleculaire Structuur | ![]() |
Dichtheid | 1.46g/cm3 |
Smeltpunt | 115-118℃ |
Kookpunt | 291.2°C at 760 mmHg |
Brekingsindex | 1.628 |
Vlampunt | 129.9°C |
Dampdruk | 0.00344mmHg at 25°C |
Veiligheid Omschrijving | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |