ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
78-19-3 3,9-Divinyl-2,4,8,10-tetraoxaspiro[5.5]undecane |
|
| Naam product | 3,9-Divinyl-2,4,8,10-tetraoxaspiro[5.5]undecane |
| Engelse naam | 3,9-Divinyl-2,4,8,10-tetraoxaspiro[5.5]undecane;3,9-Divinylspirobis(m-dioxan);3,9-diethenyl-2,4,8,10-tetraoxaspiro[5.5]undecane;3,9-Divinylspirobi(m-dioxane);3,9-Divinyl-2,4,8,10-tetraoxaspiro(5.5)undecane |
| MF | C11H16O4 |
| Molecuulgewicht | 212.2423 |
| InChI | InChI=1/C11H16O4/c1-3-9-12-5-11(6-13-9)7-14-10(4-2)15-8-11/h3-4,9-10H,1-2,5-8H2 |
| CAS-nummer | 78-19-3 |
| EINECS | 201-092-7 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.11g/cm3 |
| Smeltpunt | 43-46℃ |
| Kookpunt | 284.4°C at 760 mmHg |
| Brekingsindex | 1.493 |
| Vlampunt | 106.6°C |
| Dampdruk | 0.00512mmHg at 25°C |
| Veiligheid Omschrijving | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |