ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
78246-49-8 Paroxetine HCL |
|
| Naam product | Paroxetine HCL |
| Engelse naam | Paroxetine HCL;(3S-trans)-3-[(1,3-Benzodioxol-5-yloxy)methyl]-4-(4-fluorophenyl)piperidine hydrochloride;Paroxetine Hydrochloride Anhydrous;Paroxetine Hydrochloride;(3S,4R)-3-[(1,3-benzodioxol-5-yloxy)methyl]-4-(4-fluorophenyl)piperidine;3-[(1,3-benzodioxol-5-yloxy)methyl]-4-(4-fluorophenyl)piperidine hydrochloride;Paroxetine HCl,Anhydrous |
| MF | C19H21ClFNO3 |
| Molecuulgewicht | 365.8263 |
| InChI | InChI=1/C19H20FNO3.ClH/c20-15-3-1-13(2-4-15)17-7-8-21-10-14(17)11-22-16-5-6-18-19(9-16)24-12-23-18;/h1-6,9,14,17,21H,7-8,10-12H2;1H |
| CAS-nummer | 78246-49-8 |
| Moleculaire Structuur | ![]() |
| Smeltpunt | 129-131℃ |
| Kookpunt | 451.7°C at 760 mmHg |
| Vlampunt | 227°C |
| Dampdruk | 2.39E-08mmHg at 25°C |
| MSDS | |