ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
79-15-2 N-bromoacetamide |
|
| Naam product | N-bromoacetamide |
| Engelse naam | N-bromoacetamide;N-Bromoacetamide;CCRIS 4590;Acetamide, N-bromo- |
| MF | C2H4BrNO |
| Molecuulgewicht | 137.9633 |
| InChI | InChI=1/C2H4BrNO/c1-2(5)4-3/h1H3,(H,4,5) |
| CAS-nummer | 79-15-2 |
| EINECS | 201-181-0 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.71g/cm3 |
| Brekingsindex | 1.474 |
| Risico-codes | R34##Causes burns.:; |
| Veiligheid Omschrijving | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |