ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
81-88-9 Rhodamine B |
|
| Naam product | Rhodamine B |
| Engelse naam | Rhodamine B;Basic Rhodamine B;Basic violet 10(C.I.45170);C.I. 45170;C.I. Basic Violet 10;C.I. Food Red 15;C.I. No. 45170;Rhodamine B;Basic Violet 10;Tetraethylrhodamine;Rhodamine B solution;rhodamine B for microscopy;rhodamine B (laser dye);Basic Violet 10 (C.I.);9-(2-carboxyphenyl)-3,6-bis(diethylamino)xanthylium chloride;N-[9-(2-carboxyphenyl)-6-(diethylamino)-3H-xanthen-3-ylidene]-N-ethylethanaminium chloride;Basic rose red;Basic Viloet10;C.I.Basic Violet 10 |
| MF | C28H31ClN2O3 |
| Molecuulgewicht | 479.0103 |
| InChI | InChI=1/C28H30N2O3.ClH/c1-5-29(6-2)19-13-15-23-25(17-19)33-26-18-20(30(7-3)8-4)14-16-24(26)27(23)21-11-9-10-12-22(21)28(31)32;/h9-18H,5-8H2,1-4H3;1H |
| CAS-nummer | 81-88-9 |
| EINECS | 201-383-9 |
| Moleculaire Structuur | ![]() |
| Smeltpunt | 210-211℃ (dec.) |
| Oplosbaarheid in water | SOLUBLE |
| Gevaarsymbolen | |
| Risico-codes | R22||R41||R68:; |
| Veiligheid Omschrijving | S26||S36/37/39:; |
| MSDS | |