ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
817-76-5 methyl 3-chlorobutanoate |
|
| Naam product | methyl 3-chlorobutanoate |
| Engelse naam | methyl 3-chlorobutanoate;3-Chlorobutanoic acid methyl ester;butanoic acid, 3-chloro-, methyl ester;Methyl 3-chlorobutanoate;Methyl 3-chlorobutyrate |
| MF | C5H9ClO2 |
| Molecuulgewicht | 136.5768 |
| InChI | InChI=1/C5H9ClO2/c1-4(6)3-5(7)8-2/h4H,3H2,1-2H3 |
| CAS-nummer | 817-76-5 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.081g/cm3 |
| Kookpunt | 150°C at 760 mmHg |
| Brekingsindex | 1.417 |
| Vlampunt | 48.1°C |
| Dampdruk | 3.92mmHg at 25°C |
| MSDS | |