ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
817-97-0 O-ethyl prop-2-en-1-ylthiocarbamate |
|
| Naam product | O-ethyl prop-2-en-1-ylthiocarbamate |
| Engelse naam | O-ethyl prop-2-en-1-ylthiocarbamate; |
| MF | C6H11NOS |
| Molecuulgewicht | 145.2226 |
| InChI | InChI=1/C6H11NOS/c1-3-5-7-6(9)8-4-2/h3H,1,4-5H2,2H3,(H,7,9) |
| CAS-nummer | 817-97-0 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.016g/cm3 |
| Kookpunt | 170°C at 760 mmHg |
| Brekingsindex | 1.502 |
| Vlampunt | 56.6°C |
| Dampdruk | 1.5mmHg at 25°C |
| MSDS | |