ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
822-86-6 trans-1,2-Dichlorocyclohexane |
|
Naam product | trans-1,2-Dichlorocyclohexane |
Engelse naam | trans-1,2-Dichlorocyclohexane;Dychlorocyclohexane;trans-1,2-Dychlorocyclohexane;1,2-dichlorocyclohexane;(1R,2R)-1,2-dichlorocyclohexane;(1R)-1,2-dichlorocyclohexane |
MF | C6H10Cl2 |
Molecuulgewicht | 153.0496 |
InChI | InChI=1/C6H10Cl2/c7-5-3-1-2-4-6(5)8/h5-6H,1-4H2/t5-,6?/m1/s1 |
CAS-nummer | 822-86-6 |
EINECS | 212-503-4 |
Moleculaire Structuur | ![]() |
Dichtheid | 1.14g/cm3 |
Kookpunt | 198°C at 760 mmHg |
Brekingsindex | 1.472 |
Vlampunt | 66.1°C |
Dampdruk | 0.518mmHg at 25°C |
Veiligheid Omschrijving | S24/25##Avoid contact with skin and eyes.:; |
MSDS |