ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
83-05-6 bis(4-chlorophenyl)acetic acid |
|
| Naam product | bis(4-chlorophenyl)acetic acid |
| Engelse naam | bis(4-chlorophenyl)acetic acid;bis(p-chlorophenyl)acetic acid;4,4-DDA |
| MF | C14H10Cl2O2 |
| Molecuulgewicht | 281.134 |
| InChI | InChI=1/C14H10Cl2O2/c15-11-5-1-9(2-6-11)13(14(17)18)10-3-7-12(16)8-4-10/h1-8,13H,(H,17,18) |
| CAS-nummer | 83-05-6 |
| EINECS | 201-451-8 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.373g/cm3 |
| Smeltpunt | 167-169℃ |
| Kookpunt | 411.4°C at 760 mmHg |
| Brekingsindex | 1.616 |
| Vlampunt | 202.6°C |
| Dampdruk | 1.66E-07mmHg at 25°C |
| MSDS | |