ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
83-56-7 1,5-Dihydroxynaphthalene |
|
| Naam product | 1,5-Dihydroxynaphthalene |
| Engelse naam | 1,5-Dihydroxynaphthalene;C.I. 76625;CI 76625;1,5-Naphthalenediol;1,5-dihydroxy naphthalene;naphthalene-1,5-diol;1,5-Dihydoroxy naphthalene |
| MF | C10H8O2 |
| Molecuulgewicht | 160.1693 |
| InChI | InChI=1/C10H8O2/c11-9-5-1-3-7-8(9)4-2-6-10(7)12/h1-6,11-12H |
| CAS-nummer | 83-56-7 |
| EINECS | 201-487-4 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.33g/cm3 |
| Smeltpunt | 259-261℃ |
| Kookpunt | 375.4°C at 760 mmHg |
| Brekingsindex | 1.725 |
| Vlampunt | 193.5°C |
| Dampdruk | 3.62E-06mmHg at 25°C |
| Gevaarsymbolen | |
| Risico-codes | R22||R36||R51/53:; |
| Veiligheid Omschrijving | S29||S39||S61:; |
| MSDS | |